C9H23N2O2+ — CID 12902130
[2-(dimethylamino)-2,2-dimethoxyethyl]-trimethylazanium (PubChem CID 12902130) has the molecular formula C9H23N2O2+ and a molecular weight of 191.29 g/mol. Its IUPAC name is [2-(dimethylamino)-2,2-dimethoxyethyl]-trimethylazanium.
| Compound Name | [2-(dimethylamino)-2,2-dimethoxyethyl]-trimethylazanium |
|---|---|
| PubChem CID | 12902130 |
| Molecular Formula | C9H23N2O2+ |
| Molecular Weight | 191.29 g/mol |
| Exact Mass | 191.18 |
| IUPAC Name | [2-(dimethylamino)-2,2-dimethoxyethyl]-trimethylazanium |
| SMILES | COC(C[N+](C)(C)C)(OC)N(C)C |
| InChI | InChI=1S/C9H23N2O2/c1-10(2)9(12-6,13-7)8-11(3,4)5/h8H2,1-7H3/q+1 |
| InChIKey | ZJPVHZATYOAFTK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|