C9H24NO3Si+ — CID 174419403
trimethyl-(1,2,2-trimethoxy-1-silylpropyl)azanium (PubChem CID 174419403) has the molecular formula C9H24NO3Si+ and a molecular weight of 222.38 g/mol. Its IUPAC name is trimethyl-(1,2,2-trimethoxy-1-silylpropyl)azanium.
| Compound Name | trimethyl-(1,2,2-trimethoxy-1-silylpropyl)azanium |
|---|---|
| PubChem CID | 174419403 |
| Molecular Formula | C9H24NO3Si+ |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | trimethyl-(1,2,2-trimethoxy-1-silylpropyl)azanium |
| SMILES | COC(C)(OC)C([SiH3])(OC)[N+](C)(C)C |
| InChI | InChI=1S/C9H24NO3Si/c1-8(11-5,12-6)9(14,13-7)10(2,3)4/h1-7,14H3/q+1 |
| InChIKey | NKZQYLVJHVMSFJ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|