C9H21NO3Si — CID 174425524
1,2,2-trimethoxy-N-prop-2-enyl-1-silylpropan-1-amine (PubChem CID 174425524) has the molecular formula C9H21NO3Si and a molecular weight of 219.36 g/mol. Its IUPAC name is 1,2,2-trimethoxy-N-prop-2-enyl-1-silylpropan-1-amine.
| Compound Name | 1,2,2-trimethoxy-N-prop-2-enyl-1-silylpropan-1-amine |
|---|---|
| PubChem CID | 174425524 |
| Molecular Formula | C9H21NO3Si |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1,2,2-trimethoxy-N-prop-2-enyl-1-silylpropan-1-amine |
| SMILES | C=CCNC([SiH3])(OC)C(C)(OC)OC |
| InChI | InChI=1S/C9H21NO3Si/c1-6-7-10-9(14,13-5)8(2,11-3)12-4/h6,10H,1,7H2,2-5,14H3 |
| InChIKey | WZPSRDIDUJGQPC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|