C11H24IN3O — CID 110032990
2-(4-methoxy-2,2-dimethylbutyl)-1-prop-2-enylguanidine;hydroiodide (PubChem CID 110032990) has the molecular formula C11H24IN3O and a molecular weight of 341.24 g/mol. Its IUPAC name is 2-(4-methoxy-2,2-dimethylbutyl)-1-prop-2-enylguanidine;hydroiodide.
| Compound Name | 2-(4-methoxy-2,2-dimethylbutyl)-1-prop-2-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110032990 |
| Molecular Formula | C11H24IN3O |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | 2-(4-methoxy-2,2-dimethylbutyl)-1-prop-2-enylguanidine;hydroiodide |
| SMILES | C=CCN/C(N)=N/CC(C)(C)CCOC.I |
| InChI | InChI=1S/C11H23N3O.HI/c1-5-7-13-10(12)14-9-11(2,3)6-8-15-4;/h5H,1,6-9H2,2-4H3,(H3,12,13,14);1H |
| InChIKey | VDBBRAJQERLVLQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|