C11H24N2Si — CID 173002811
2,2-dimethyl-1-N,1-N'-bis(prop-2-enyl)-1-silylpropane-1,1-diamine (PubChem CID 173002811) has the molecular formula C11H24N2Si and a molecular weight of 212.41 g/mol. Its IUPAC name is 2,2-dimethyl-1-N,1-N'-bis(prop-2-enyl)-1-silylpropane-1,1-diamine.
| Compound Name | 2,2-dimethyl-1-N,1-N'-bis(prop-2-enyl)-1-silylpropane-1,1-diamine |
|---|---|
| PubChem CID | 173002811 |
| Molecular Formula | C11H24N2Si |
| Molecular Weight | 212.41 g/mol |
| Exact Mass | 212.17 |
| IUPAC Name | 2,2-dimethyl-1-N,1-N'-bis(prop-2-enyl)-1-silylpropane-1,1-diamine |
| SMILES | C=CCNC([SiH3])(NCC=C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2Si/c1-6-8-12-11(14,10(3,4)5)13-9-7-2/h6-7,12-13H,1-2,8-9H2,3-5,14H3 |
| InChIKey | CMEPFTJYNMHEDQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|