C7H8F7N — CID 175461087
1,1,2,2,4,4,4-heptafluoro-N-prop-2-enylbutan-1-amine (PubChem CID 175461087) has the molecular formula C7H8F7N and a molecular weight of 239.13 g/mol. Its IUPAC name is 1,1,2,2,4,4,4-heptafluoro-N-prop-2-enylbutan-1-amine.
| Compound Name | 1,1,2,2,4,4,4-heptafluoro-N-prop-2-enylbutan-1-amine |
|---|---|
| PubChem CID | 175461087 |
| Molecular Formula | C7H8F7N |
| Molecular Weight | 239.13 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1,1,2,2,4,4,4-heptafluoro-N-prop-2-enylbutan-1-amine |
| SMILES | C=CCNC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C7H8F7N/c1-2-3-15-7(13,14)5(8,9)4-6(10,11)12/h2,15H,1,3-4H2 |
| InChIKey | OAOAEZZUTYANEV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.13 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|