C11H25NO2Si — CID 174882901
(3,3-dimethoxy-2-piperidin-3-ylbutan-2-yl)silane (PubChem CID 174882901) has the molecular formula C11H25NO2Si and a molecular weight of 231.41 g/mol. Its IUPAC name is (3,3-dimethoxy-2-piperidin-3-ylbutan-2-yl)silane.
| Compound Name | (3,3-dimethoxy-2-piperidin-3-ylbutan-2-yl)silane |
|---|---|
| PubChem CID | 174882901 |
| Molecular Formula | C11H25NO2Si |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (3,3-dimethoxy-2-piperidin-3-ylbutan-2-yl)silane |
| SMILES | COC(C)(OC)C(C)([SiH3])C1CCCNC1 |
| InChI | InChI=1S/C11H25NO2Si/c1-10(15,11(2,13-3)14-4)9-6-5-7-12-8-9/h9,12H,5-8H2,1-4,15H3 |
| InChIKey | ADUDTMNULZCFQN-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|