C8H17NO2 — CID 171842996
(2S)-2-[(3R)-piperidin-3-yl]propane-1,2-diol (PubChem CID 171842996) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is (2S)-2-[(3R)-piperidin-3-yl]propane-1,2-diol.
| Compound Name | (2S)-2-[(3R)-piperidin-3-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 171842996 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | (2S)-2-[(3R)-piperidin-3-yl]propane-1,2-diol |
| SMILES | C[C@@](O)(CO)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C8H17NO2/c1-8(11,6-10)7-3-2-4-9-5-7/h7,9-11H,2-6H2,1H3/t7-,8-/m1/s1 |
| InChIKey | MLWSXVBBEZLNMV-HTQZYQBOSA-N |
| XLogP | -0.27 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |