C13H27NO — CID 65146059
5,5-dimethyl-2-piperidin-3-ylhexan-2-ol (PubChem CID 65146059) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 5,5-dimethyl-2-piperidin-3-ylhexan-2-ol.
| Compound Name | 5,5-dimethyl-2-piperidin-3-ylhexan-2-ol |
|---|---|
| PubChem CID | 65146059 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 5,5-dimethyl-2-piperidin-3-ylhexan-2-ol |
| SMILES | CC(C)(C)CCC(C)(O)C1CCCNC1 |
| InChI | InChI=1S/C13H27NO/c1-12(2,3)7-8-13(4,15)11-6-5-9-14-10-11/h11,14-15H,5-10H2,1-4H3 |
| InChIKey | FMJVOAKHKZUJKF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |