C29H36FN5O4 — CID 129025334
ethyl 5-[(Z)-2-amino-1-[amino(methyl)amino]pent-1-en-3-yl]-1-[3-[2-fluoro-3-(oxan-4-yloxy)phenyl]phenyl]pyrazole-4-carboxylate (PubChem CID 129025334) has the molecular formula C29H36FN5O4 and a molecular weight of 537.64 g/mol. Its IUPAC name is ethyl 5-[(Z)-2-amino-1-[amino(methyl)amino]pent-1-en-3-yl]-1-[3-[2-fluoro-3-(oxan-4-yloxy)phenyl]phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[(Z)-2-amino-1-[amino(methyl)amino]pent-1-en-3-yl]-1-[3-[2-fluoro-3-(oxan-4-yloxy)phenyl]phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 129025334 |
| Molecular Formula | C29H36FN5O4 |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | ethyl 5-[(Z)-2-amino-1-[amino(methyl)amino]pent-1-en-3-yl]-1-[3-[2-fluoro-3-(oxan-4-yloxy)phenyl]phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(-c3cccc(OC4CCOCC4)c3F)c2)c1C(CC)/C(N)=C/N(C)N |
| InChI | InChI=1S/C29H36FN5O4/c1-4-22(25(31)18-34(3)32)28-24(29(36)38-5-2)17-33-35(28)20-9-6-8-19(16-20)23-10-7-11-26(27(23)30)39-21-12-14-37-15-13-21/h6-11,16-18,21-22H,4-5,12-15,31-32H2,1-3H3/b25-18- |
| InChIKey | HLGHAUASTJAQDT-BWAHOGKJSA-N |
| XLogP | 4.51 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|