C24H27N5O3 — CID 129024850
ethyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-[3-(3-hydroxyphenyl)phenyl]pyrazole-4-carboxylate (PubChem CID 129024850) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is ethyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-[3-(3-hydroxyphenyl)phenyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-[3-(3-hydroxyphenyl)phenyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 129024850 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | ethyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-[3-(3-hydroxyphenyl)phenyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2cccc(-c3cccc(O)c3)c2)c1C1CC1/C(N)=C/N(C)N |
| InChI | InChI=1S/C24H27N5O3/c1-3-32-24(31)21-13-27-29(23(21)20-12-19(20)22(25)14-28(2)26)17-8-4-6-15(10-17)16-7-5-9-18(30)11-16/h4-11,13-14,19-20,30H,3,12,25-26H2,1-2H3/b22-14- |
| InChIKey | SUYXQMFYCNEJQU-HMAPJEAMSA-N |
| XLogP | 3.13 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|