C18H22BrN5O2 — CID 129025028
methyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-(3-bromo-5-methylphenyl)pyrazole-4-carboxylate (PubChem CID 129025028) has the molecular formula C18H22BrN5O2 and a molecular weight of 420.31 g/mol. Its IUPAC name is methyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-(3-bromo-5-methylphenyl)pyrazole-4-carboxylate.
| Compound Name | methyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-(3-bromo-5-methylphenyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 129025028 |
| Molecular Formula | C18H22BrN5O2 |
| Molecular Weight | 420.31 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | methyl 5-[2-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]cyclopropyl]-1-(3-bromo-5-methylphenyl)pyrazole-4-carboxylate |
| SMILES | COC(=O)c1cnn(-c2cc(C)cc(Br)c2)c1C1CC1/C(N)=C/N(C)N |
| InChI | InChI=1S/C18H22BrN5O2/c1-10-4-11(19)6-12(5-10)24-17(15(8-22-24)18(25)26-3)14-7-13(14)16(20)9-23(2)21/h4-6,8-9,13-14H,7,20-21H2,1-3H3/b16-9- |
| InChIKey | BSVWWYQBBTXXQO-SXGWCWSVSA-N |
| XLogP | 2.44 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|