C19H16Cl2N2O3 — CID 129027199
5-[3-(2,3-dichlorophenoxy)prop-1-ynyl]-3-hydroxy-N-(2-methylprop-2-enyl)pyridine-2-carboxamide (PubChem CID 129027199) has the molecular formula C19H16Cl2N2O3 and a molecular weight of 391.25 g/mol. Its IUPAC name is 5-[3-(2,3-dichlorophenoxy)prop-1-ynyl]-3-hydroxy-N-(2-methylprop-2-enyl)pyridine-2-carboxamide.
| Compound Name | 5-[3-(2,3-dichlorophenoxy)prop-1-ynyl]-3-hydroxy-N-(2-methylprop-2-enyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129027199 |
| Molecular Formula | C19H16Cl2N2O3 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 5-[3-(2,3-dichlorophenoxy)prop-1-ynyl]-3-hydroxy-N-(2-methylprop-2-enyl)pyridine-2-carboxamide |
| SMILES | C=C(C)CNC(=O)c1ncc(C#CCOc2cccc(Cl)c2Cl)cc1O |
| InChI | InChI=1S/C19H16Cl2N2O3/c1-12(2)10-23-19(25)18-15(24)9-13(11-22-18)5-4-8-26-16-7-3-6-14(20)17(16)21/h3,6-7,9,11,24H,1,8,10H2,2H3,(H,23,25) |
| InChIKey | OOVWEYSZAYFKEQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|