C27H25N3O2 — CID 129027685
[8-methyl-2-(1-methylbenzimidazol-2-yl)-5-[(1R)-1-phenylethoxy]quinolin-4-yl]methanol (PubChem CID 129027685) has the molecular formula C27H25N3O2 and a molecular weight of 423.52 g/mol. Its IUPAC name is [8-methyl-2-(1-methylbenzimidazol-2-yl)-5-[(1R)-1-phenylethoxy]quinolin-4-yl]methanol.
| Compound Name | [8-methyl-2-(1-methylbenzimidazol-2-yl)-5-[(1R)-1-phenylethoxy]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 129027685 |
| Molecular Formula | C27H25N3O2 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | [8-methyl-2-(1-methylbenzimidazol-2-yl)-5-[(1R)-1-phenylethoxy]quinolin-4-yl]methanol |
| SMILES | Cc1ccc(O[C@H](C)c2ccccc2)c2c(CO)cc(-c3nc4ccccc4n3C)nc12 |
| InChI | InChI=1S/C27H25N3O2/c1-17-13-14-24(32-18(2)19-9-5-4-6-10-19)25-20(16-31)15-22(28-26(17)25)27-29-21-11-7-8-12-23(21)30(27)3/h4-15,18,31H,16H2,1-3H3/t18-/m1/s1 |
| InChIKey | IZPQYRWBCPWTDH-GOSISDBHSA-N |
| XLogP | 5.73 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |