C19H16ClN3 — CID 129028730
9-chloro-6-ethenyl-3-pyrimidin-4-yl-1,2,3,4-tetrahydroacridine (PubChem CID 129028730) has the molecular formula C19H16ClN3 and a molecular weight of 321.81 g/mol. Its IUPAC name is 9-chloro-6-ethenyl-3-pyrimidin-4-yl-1,2,3,4-tetrahydroacridine.
| Compound Name | 9-chloro-6-ethenyl-3-pyrimidin-4-yl-1,2,3,4-tetrahydroacridine |
|---|---|
| PubChem CID | 129028730 |
| Molecular Formula | C19H16ClN3 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 9-chloro-6-ethenyl-3-pyrimidin-4-yl-1,2,3,4-tetrahydroacridine |
| SMILES | C=Cc1ccc2c(Cl)c3c(nc2c1)CC(c1ccncn1)CC3 |
| InChI | InChI=1S/C19H16ClN3/c1-2-12-3-5-14-17(9-12)23-18-10-13(4-6-15(18)19(14)20)16-7-8-21-11-22-16/h2-3,5,7-9,11,13H,1,4,6,10H2 |
| InChIKey | JXNJGZXEGWSILZ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |