C19H24N2O5 — CID 129028983
methyl 5-acetamido-2-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoate (PubChem CID 129028983) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl 5-acetamido-2-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoate.
| Compound Name | methyl 5-acetamido-2-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoate |
|---|---|
| PubChem CID | 129028983 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | methyl 5-acetamido-2-methyl-4-[3-[(2-methylpropan-2-yl)oxycarbonylamino]prop-1-ynyl]benzoate |
| SMILES | COC(=O)c1cc(NC(C)=O)c(C#CCNC(=O)OC(C)(C)C)cc1C |
| InChI | InChI=1S/C19H24N2O5/c1-12-10-14(8-7-9-20-18(24)26-19(3,4)5)16(21-13(2)22)11-15(12)17(23)25-6/h10-11H,9H2,1-6H3,(H,20,24)(H,21,22) |
| InChIKey | ZZZYRFAZIXYNHF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|