C7H12N2 — CID 129029765
N'-[(1Z,3Z)-penta-1,3-dienyl]ethanimidamide (PubChem CID 129029765) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is N'-[(1Z,3Z)-penta-1,3-dienyl]ethanimidamide.
| Compound Name | N'-[(1Z,3Z)-penta-1,3-dienyl]ethanimidamide |
|---|---|
| PubChem CID | 129029765 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N'-[(1Z,3Z)-penta-1,3-dienyl]ethanimidamide |
| SMILES | C/C=C\C=C/N=C(\C)N |
| InChI | InChI=1S/C7H12N2/c1-3-4-5-6-9-7(2)8/h3-6H,1-2H3,(H2,8,9)/b4-3-,6-5- |
| InChIKey | XBSWCCIINCMVLY-OUPQRBNQSA-N |
| XLogP | 1.45 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|