C23H31N5O3 — CID 129030414
N-[(2R)-2-hydroxypropyl]-2-morpholin-4-yl-8-[1-[[(3E)-penta-1,3-dien-3-yl]amino]ethyl]quinoxaline-6-carboxamide (PubChem CID 129030414) has the molecular formula C23H31N5O3 and a molecular weight of 425.53 g/mol. Its IUPAC name is N-[(2R)-2-hydroxypropyl]-2-morpholin-4-yl-8-[1-[[(3E)-penta-1,3-dien-3-yl]amino]ethyl]quinoxaline-6-carboxamide.
| Compound Name | N-[(2R)-2-hydroxypropyl]-2-morpholin-4-yl-8-[1-[[(3E)-penta-1,3-dien-3-yl]amino]ethyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 129030414 |
| Molecular Formula | C23H31N5O3 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | N-[(2R)-2-hydroxypropyl]-2-morpholin-4-yl-8-[1-[[(3E)-penta-1,3-dien-3-yl]amino]ethyl]quinoxaline-6-carboxamide |
| SMILES | C=C/C(=C\C)NC(C)c1cc(C(=O)NC[C@@H](C)O)cc2ncc(N3CCOCC3)nc12 |
| InChI | InChI=1S/C23H31N5O3/c1-5-18(6-2)26-16(4)19-11-17(23(30)25-13-15(3)29)12-20-22(19)27-21(14-24-20)28-7-9-31-10-8-28/h5-6,11-12,14-16,26,29H,1,7-10,13H2,2-4H3,(H,25,30)/b18-6+/t15-,16?/m1/s1 |
| InChIKey | NBBCQQHQCPOIDY-QADCSKMPSA-N |
| XLogP | 2.32 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|