C8H14N2 — CID 129033363
methyl-[(3Z)-5-methylhexa-3,5-dien-3-yl]diazene (PubChem CID 129033363) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is methyl-[(3Z)-5-methylhexa-3,5-dien-3-yl]diazene.
| Compound Name | methyl-[(3Z)-5-methylhexa-3,5-dien-3-yl]diazene |
|---|---|
| PubChem CID | 129033363 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | methyl-[(3Z)-5-methylhexa-3,5-dien-3-yl]diazene |
| SMILES | C=C(C)/C=C(CC)\N=N\C |
| InChI | InChI=1S/C8H14N2/c1-5-8(10-9-4)6-7(2)3/h6H,2,5H2,1,3-4H3/b8-6-,10-9+ |
| InChIKey | MNVPDNFROHIYMT-JWJWWGMXSA-N |
| XLogP | 2.94 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|