C36H23N — CID 129034397
3-naphthalen-2-yl-10-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene (PubChem CID 129034397) has the molecular formula C36H23N and a molecular weight of 474.62 g/mol. Its IUPAC name is 3-naphthalen-2-yl-10-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene.
| Compound Name | 3-naphthalen-2-yl-10-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene |
|---|---|
| PubChem CID | 129034397 |
| Molecular Formula | C36H23N |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | 3-naphthalen-2-yl-10-(2,3,4,5,6-pentadeuteriophenyl)-15-phenyl-15-azatetracyclo[10.2.1.05,14.08,13]pentadeca-1(14),2,4,6,8,10,12-heptaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc3ccc4cc(-c5ccc6ccccc6c5)cc5c4c3c(c2)n5-c2ccccc2)c([2H])c1[2H] |
| InChI | InChI=1S/C36H23N/c1-3-9-24(10-4-1)30-20-28-17-18-29-21-31(27-16-15-25-11-7-8-12-26(25)19-27)23-34-36(29)35(28)33(22-30)37(34)32-13-5-2-6-14-32/h1-23H/i1D,3D,4D,9D,10D |
| InChIKey | KWERVHZDIWNTDV-MBRJKSRSSA-N |
| XLogP | 9.86 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|