C28H38Cl2N2O5S — CID 129034469
2-[(3S,5R)-3-amino-5-[(3Z,5E)-6-chlorohepta-1,3,5-trien-4-yl]-6-(4-chlorophenyl)-1-[(2S)-3-methyl-1-propan-2-ylsulfonylbutan-2-yl]-2-oxopiperidin-3-yl]acetic acid (PubChem CID 129034469) has the molecular formula C28H38Cl2N2O5S and a molecular weight of 585.59 g/mol. Its IUPAC name is 2-[(3S,5R)-3-amino-5-[(3Z,5E)-6-chlorohepta-1,3,5-trien-4-yl]-6-(4-chlorophenyl)-1-[(2S)-3-methyl-1-propan-2-ylsulfonylbutan-2-yl]-2-oxopiperidin-3-yl]acetic acid.
| Compound Name | 2-[(3S,5R)-3-amino-5-[(3Z,5E)-6-chlorohepta-1,3,5-trien-4-yl]-6-(4-chlorophenyl)-1-[(2S)-3-methyl-1-propan-2-ylsulfonylbutan-2-yl]-2-oxopiperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 129034469 |
| Molecular Formula | C28H38Cl2N2O5S |
| Molecular Weight | 585.59 g/mol |
| Exact Mass | 584.19 |
| IUPAC Name | 2-[(3S,5R)-3-amino-5-[(3Z,5E)-6-chlorohepta-1,3,5-trien-4-yl]-6-(4-chlorophenyl)-1-[(2S)-3-methyl-1-propan-2-ylsulfonylbutan-2-yl]-2-oxopiperidin-3-yl]acetic acid |
| SMILES | C=C/C=C(\C=C(/C)Cl)[C@H]1C[C@](N)(CC(=O)O)C(=O)N([C@H](CS(=O)(=O)C(C)C)C(C)C)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H38Cl2N2O5S/c1-7-8-21(13-19(6)29)23-14-28(31,15-25(33)34)27(35)32(26(23)20-9-11-22(30)12-10-20)24(17(2)3)16-38(36,37)18(4)5/h7-13,17-18,23-24,26H,1,14-16,31H2,2-6H3,(H,33,34)/b19-13+,21-8+/t23-,24-,26?,28+/m1/s1 |
| InChIKey | OPVPRMKDTFEVMP-MMAGLUCDSA-N |
| XLogP | 5.50 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|