C25H31N3O3 — CID 129036051
[5-cyclopropyl-2-[[1-(cyclopropylmethyl)-7-(3-methoxypropyl)indol-5-yl]amino]-3-pyridinyl]methanediol (PubChem CID 129036051) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is [5-cyclopropyl-2-[[1-(cyclopropylmethyl)-7-(3-methoxypropyl)indol-5-yl]amino]-3-pyridinyl]methanediol.
| Compound Name | [5-cyclopropyl-2-[[1-(cyclopropylmethyl)-7-(3-methoxypropyl)indol-5-yl]amino]-3-pyridinyl]methanediol |
|---|---|
| PubChem CID | 129036051 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | [5-cyclopropyl-2-[[1-(cyclopropylmethyl)-7-(3-methoxypropyl)indol-5-yl]amino]-3-pyridinyl]methanediol |
| SMILES | COCCCc1cc(Nc2ncc(C3CC3)cc2C(O)O)cc2ccn(CC3CC3)c12 |
| InChI | InChI=1S/C25H31N3O3/c1-31-10-2-3-18-11-21(12-19-8-9-28(23(18)19)15-16-4-5-16)27-24-22(25(29)30)13-20(14-26-24)17-6-7-17/h8-9,11-14,16-17,25,29-30H,2-7,10,15H2,1H3,(H,26,27) |
| InChIKey | BRZXCMQRACWPQX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|