C27H33N3O2 — CID 90153032
tert-butyl 2-[[1-(cyclopentylmethyl)indol-4-yl]amino]-5-cyclopropylpyridine-3-carboxylate (PubChem CID 90153032) has the molecular formula C27H33N3O2 and a molecular weight of 431.58 g/mol. Its IUPAC name is tert-butyl 2-[[1-(cyclopentylmethyl)indol-4-yl]amino]-5-cyclopropylpyridine-3-carboxylate.
| Compound Name | tert-butyl 2-[[1-(cyclopentylmethyl)indol-4-yl]amino]-5-cyclopropylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 90153032 |
| Molecular Formula | C27H33N3O2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | tert-butyl 2-[[1-(cyclopentylmethyl)indol-4-yl]amino]-5-cyclopropylpyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(C2CC2)cnc1Nc1cccc2c1ccn2CC1CCCC1 |
| InChI | InChI=1S/C27H33N3O2/c1-27(2,3)32-26(31)22-15-20(19-11-12-19)16-28-25(22)29-23-9-6-10-24-21(23)13-14-30(24)17-18-7-4-5-8-18/h6,9-10,13-16,18-19H,4-5,7-8,11-12,17H2,1-3H3,(H,28,29) |
| InChIKey | LZHGHKGJPWMPLW-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |