C24H22N4O2 — CID 144618920
methyl 5-cyclopropyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]quinazolin-8-yl]amino]pyridine-3-carboxylate (PubChem CID 144618920) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is methyl 5-cyclopropyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]quinazolin-8-yl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 5-cyclopropyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]quinazolin-8-yl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 144618920 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | methyl 5-cyclopropyl-2-[[4-[(3E)-hexa-1,3,5-trien-3-yl]quinazolin-8-yl]amino]pyridine-3-carboxylate |
| SMILES | C=C/C=C(\C=C)c1ncnc2c(Nc3ncc(C4CC4)cc3C(=O)OC)cccc12 |
| InChI | InChI=1S/C24H22N4O2/c1-4-7-15(5-2)21-18-8-6-9-20(22(18)27-14-26-21)28-23-19(24(29)30-3)12-17(13-25-23)16-10-11-16/h4-9,12-14,16H,1-2,10-11H2,3H3,(H,25,28)/b15-7+ |
| InChIKey | MFWSJOFDFHTAJB-VIZOYTHASA-N |
| XLogP | 5.19 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|