C26H31N3O3 — CID 90153083
tert-butyl 5-cyclopropyl-2-[[1-(oxolan-3-ylmethyl)indol-4-yl]amino]pyridine-3-carboxylate (PubChem CID 90153083) has the molecular formula C26H31N3O3 and a molecular weight of 433.55 g/mol. Its IUPAC name is tert-butyl 5-cyclopropyl-2-[[1-(oxolan-3-ylmethyl)indol-4-yl]amino]pyridine-3-carboxylate.
| Compound Name | tert-butyl 5-cyclopropyl-2-[[1-(oxolan-3-ylmethyl)indol-4-yl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90153083 |
| Molecular Formula | C26H31N3O3 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | tert-butyl 5-cyclopropyl-2-[[1-(oxolan-3-ylmethyl)indol-4-yl]amino]pyridine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cc(C2CC2)cnc1Nc1cccc2c1ccn2CC1CCOC1 |
| InChI | InChI=1S/C26H31N3O3/c1-26(2,3)32-25(30)21-13-19(18-7-8-18)14-27-24(21)28-22-5-4-6-23-20(22)9-11-29(23)15-17-10-12-31-16-17/h4-6,9,11,13-14,17-18H,7-8,10,12,15-16H2,1-3H3,(H,27,28) |
| InChIKey | ADRQFEGHIGFZMS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |