C27H29N3O2 — CID 129035821
[5-cyclopropyl-2-[(1-phenylindol-4-yl)amino]-3-pyridinyl]-[(2-methylpropan-2-yl)oxy]methanol (PubChem CID 129035821) has the molecular formula C27H29N3O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is [5-cyclopropyl-2-[(1-phenylindol-4-yl)amino]-3-pyridinyl]-[(2-methylpropan-2-yl)oxy]methanol.
| Compound Name | [5-cyclopropyl-2-[(1-phenylindol-4-yl)amino]-3-pyridinyl]-[(2-methylpropan-2-yl)oxy]methanol |
|---|---|
| PubChem CID | 129035821 |
| Molecular Formula | C27H29N3O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | [5-cyclopropyl-2-[(1-phenylindol-4-yl)amino]-3-pyridinyl]-[(2-methylpropan-2-yl)oxy]methanol |
| SMILES | CC(C)(C)OC(O)c1cc(C2CC2)cnc1Nc1cccc2c1ccn2-c1ccccc1 |
| InChI | InChI=1S/C27H29N3O2/c1-27(2,3)32-26(31)22-16-19(18-12-13-18)17-28-25(22)29-23-10-7-11-24-21(23)14-15-30(24)20-8-5-4-6-9-20/h4-11,14-18,26,31H,12-13H2,1-3H3,(H,28,29) |
| InChIKey | RPIGBCCFOFIJRU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|