C12H17IN2 — CID 163873811
5-cyclopropyl-N-(iodomethyl)-3-propan-2-ylpyridin-2-amine (PubChem CID 163873811) has the molecular formula C12H17IN2 and a molecular weight of 316.19 g/mol. Its IUPAC name is 5-cyclopropyl-N-(iodomethyl)-3-propan-2-ylpyridin-2-amine.
| Compound Name | 5-cyclopropyl-N-(iodomethyl)-3-propan-2-ylpyridin-2-amine |
|---|---|
| PubChem CID | 163873811 |
| Molecular Formula | C12H17IN2 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 5-cyclopropyl-N-(iodomethyl)-3-propan-2-ylpyridin-2-amine |
| SMILES | CC(C)c1cc(C2CC2)cnc1NCI |
| InChI | InChI=1S/C12H17IN2/c1-8(2)11-5-10(9-3-4-9)6-14-12(11)15-7-13/h5-6,8-9H,3-4,7H2,1-2H3,(H,14,15) |
| InChIKey | PNDCITXPUOIJFD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|