C12H18N2 — CID 130920688
4-cyclopropyl-N-(2-methylpropyl)pyridin-2-amine (PubChem CID 130920688) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-cyclopropyl-N-(2-methylpropyl)pyridin-2-amine.
| Compound Name | 4-cyclopropyl-N-(2-methylpropyl)pyridin-2-amine |
|---|---|
| PubChem CID | 130920688 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-cyclopropyl-N-(2-methylpropyl)pyridin-2-amine |
| SMILES | CC(C)CNc1cc(C2CC2)ccn1 |
| InChI | InChI=1S/C12H18N2/c1-9(2)8-14-12-7-11(5-6-13-12)10-3-4-10/h5-7,9-10H,3-4,8H2,1-2H3,(H,13,14) |
| InChIKey | ZUOZSZZAGHCZCV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |