C8H12N3O- — CID 171083586
4-(2-methylpropylamino)pyrimidin-2-olate (PubChem CID 171083586) has the molecular formula C8H12N3O- and a molecular weight of 166.20 g/mol. Its IUPAC name is 4-(2-methylpropylamino)pyrimidin-2-olate.
| Compound Name | 4-(2-methylpropylamino)pyrimidin-2-olate |
|---|---|
| PubChem CID | 171083586 |
| Molecular Formula | C8H12N3O- |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 4-(2-methylpropylamino)pyrimidin-2-olate |
| SMILES | CC(C)CNc1ccnc([O-])n1 |
| InChI | InChI=1S/C8H13N3O/c1-6(2)5-10-7-3-4-9-8(12)11-7/h3-4,6H,5H2,1-2H3,(H2,9,10,11,12)/p-1 |
| InChIKey | FYJBQIUCGAKDRW-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 60.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |