C23H24N4O2 — CID 146614177
N-[4-[4-(2,3-dimethylbut-2-enoylamino)indol-1-yl]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 146614177) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[4-[4-(2,3-dimethylbut-2-enoylamino)indol-1-yl]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[4-(2,3-dimethylbut-2-enoylamino)indol-1-yl]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 146614177 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[4-[4-(2,3-dimethylbut-2-enoylamino)indol-1-yl]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | CC(C)=C(C)C(=O)Nc1cccc2c1ccn2-c1ccnc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C23H24N4O2/c1-14(2)15(3)22(28)25-19-5-4-6-20-18(19)10-12-27(20)17-9-11-24-21(13-17)26-23(29)16-7-8-16/h4-6,9-13,16H,7-8H2,1-3H3,(H,25,28)(H,24,26,29) |
| InChIKey | IOSJMLHHQCHLML-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|