C23H17F2N5O2 — CID 146571651
N-[1-[2-(cyclopropanecarbonylamino)-4-pyridinyl]indol-4-yl]-2,3-difluoropyridine-4-carboxamide (PubChem CID 146571651) has the molecular formula C23H17F2N5O2 and a molecular weight of 433.42 g/mol. Its IUPAC name is N-[1-[2-(cyclopropanecarbonylamino)-4-pyridinyl]indol-4-yl]-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-[1-[2-(cyclopropanecarbonylamino)-4-pyridinyl]indol-4-yl]-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 146571651 |
| Molecular Formula | C23H17F2N5O2 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[1-[2-(cyclopropanecarbonylamino)-4-pyridinyl]indol-4-yl]-2,3-difluoropyridine-4-carboxamide |
| SMILES | O=C(Nc1cccc2c1ccn2-c1ccnc(NC(=O)C2CC2)c1)c1ccnc(F)c1F |
| InChI | InChI=1S/C23H17F2N5O2/c24-20-16(7-10-27-21(20)25)23(32)28-17-2-1-3-18-15(17)8-11-30(18)14-6-9-26-19(12-14)29-22(31)13-4-5-13/h1-3,6-13H,4-5H2,(H,28,32)(H,26,29,31) |
| InChIKey | NTEUYXCOVSHYSB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|