C26H27N3O2 — CID 144618962
methyl 2-[(1-benzyl-3-methyl-2,3-dihydroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate (PubChem CID 144618962) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is methyl 2-[(1-benzyl-3-methyl-2,3-dihydroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate.
| Compound Name | methyl 2-[(1-benzyl-3-methyl-2,3-dihydroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 144618962 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | methyl 2-[(1-benzyl-3-methyl-2,3-dihydroindol-5-yl)amino]-5-cyclopropylpyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(C2CC2)cnc1Nc1ccc2c(c1)C(C)CN2Cc1ccccc1 |
| InChI | InChI=1S/C26H27N3O2/c1-17-15-29(16-18-6-4-3-5-7-18)24-11-10-21(13-22(17)24)28-25-23(26(30)31-2)12-20(14-27-25)19-8-9-19/h3-7,10-14,17,19H,8-9,15-16H2,1-2H3,(H,27,28) |
| InChIKey | HPWAYLUDPBMRJC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|