C23H25N3O2 — CID 90152924
5-cyclopropyl-2-[(9-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]pyridine-3-carboxylic acid (PubChem CID 90152924) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 5-cyclopropyl-2-[(9-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]pyridine-3-carboxylic acid.
| Compound Name | 5-cyclopropyl-2-[(9-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 90152924 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 5-cyclopropyl-2-[(9-ethyl-5,6,7,8-tetrahydrocarbazol-3-yl)amino]pyridine-3-carboxylic acid |
| SMILES | CCn1c2c(c3cc(Nc4ncc(C5CC5)cc4C(=O)O)ccc31)CCCC2 |
| InChI | InChI=1S/C23H25N3O2/c1-2-26-20-6-4-3-5-17(20)18-12-16(9-10-21(18)26)25-22-19(23(27)28)11-15(13-24-22)14-7-8-14/h9-14H,2-8H2,1H3,(H,24,25)(H,27,28) |
| InChIKey | UPNZSBUSRBHVEF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|