C21H23N3O2 — CID 90153053
butyl 5-cyclopropyl-2-(1H-indol-5-ylamino)pyridine-3-carboxylate (PubChem CID 90153053) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is butyl 5-cyclopropyl-2-(1H-indol-5-ylamino)pyridine-3-carboxylate.
| Compound Name | butyl 5-cyclopropyl-2-(1H-indol-5-ylamino)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90153053 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | butyl 5-cyclopropyl-2-(1H-indol-5-ylamino)pyridine-3-carboxylate |
| SMILES | CCCCOC(=O)c1cc(C2CC2)cnc1Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C21H23N3O2/c1-2-3-10-26-21(25)18-12-16(14-4-5-14)13-23-20(18)24-17-6-7-19-15(11-17)8-9-22-19/h6-9,11-14,22H,2-5,10H2,1H3,(H,23,24) |
| InChIKey | JCWGKHHVSUBNRQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|