C27H25NO3 — CID 158130333
methyl 2-[(2-benzyl-1-oxo-3H-isoindol-5-yl)methyl]-5-cyclopropylbenzoate (PubChem CID 158130333) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is methyl 2-[(2-benzyl-1-oxo-3H-isoindol-5-yl)methyl]-5-cyclopropylbenzoate.
| Compound Name | methyl 2-[(2-benzyl-1-oxo-3H-isoindol-5-yl)methyl]-5-cyclopropylbenzoate |
|---|---|
| PubChem CID | 158130333 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | methyl 2-[(2-benzyl-1-oxo-3H-isoindol-5-yl)methyl]-5-cyclopropylbenzoate |
| SMILES | COC(=O)c1cc(C2CC2)ccc1Cc1ccc2c(c1)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C27H25NO3/c1-31-27(30)25-15-21(20-8-9-20)10-11-22(25)13-19-7-12-24-23(14-19)17-28(26(24)29)16-18-5-3-2-4-6-18/h2-7,10-12,14-15,20H,8-9,13,16-17H2,1H3 |
| InChIKey | RQPZHXFSSADKBE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |