C22H19NO3 — CID 11024415
methyl 2-benzyl-6-methyl-3-oxo-1H-benzo[f]isoindole-4-carboxylate (PubChem CID 11024415) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 2-benzyl-6-methyl-3-oxo-1H-benzo[f]isoindole-4-carboxylate.
| Compound Name | methyl 2-benzyl-6-methyl-3-oxo-1H-benzo[f]isoindole-4-carboxylate |
|---|---|
| PubChem CID | 11024415 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | methyl 2-benzyl-6-methyl-3-oxo-1H-benzo[f]isoindole-4-carboxylate |
| SMILES | COC(=O)c1c2c(cc3ccc(C)cc13)CN(Cc1ccccc1)C2=O |
| InChI | InChI=1S/C22H19NO3/c1-14-8-9-16-11-17-13-23(12-15-6-4-3-5-7-15)21(24)19(17)20(18(16)10-14)22(25)26-2/h3-11H,12-13H2,1-2H3 |
| InChIKey | RWDNLSZUQSESLH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |