C36H43N3O2 — CID 159768492
2-tert-butyl-1H-indol-5-amine;methyl 2-[(2-tert-butyl-1H-indol-5-yl)methyl]-5-cyclopropylbenzoate (PubChem CID 159768492) has the molecular formula C36H43N3O2 and a molecular weight of 549.76 g/mol. Its IUPAC name is 2-tert-butyl-1H-indol-5-amine;methyl 2-[(2-tert-butyl-1H-indol-5-yl)methyl]-5-cyclopropylbenzoate.
| Compound Name | 2-tert-butyl-1H-indol-5-amine;methyl 2-[(2-tert-butyl-1H-indol-5-yl)methyl]-5-cyclopropylbenzoate |
|---|---|
| PubChem CID | 159768492 |
| Molecular Formula | C36H43N3O2 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.34 |
| IUPAC Name | 2-tert-butyl-1H-indol-5-amine;methyl 2-[(2-tert-butyl-1H-indol-5-yl)methyl]-5-cyclopropylbenzoate |
| SMILES | CC(C)(C)c1cc2cc(N)ccc2[nH]1.COC(=O)c1cc(C2CC2)ccc1Cc1ccc2[nH]c(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C24H27NO2.C12H16N2/c1-24(2,3)22-14-19-12-15(5-10-21(19)25-22)11-18-9-8-17(16-6-7-16)13-20(18)23(26)27-4;1-12(2,3)11-7-8-6-9(13)4-5-10(8)14-11/h5,8-10,12-14,16,25H,6-7,11H2,1-4H3;4-7,14H,13H2,1-3H3 |
| InChIKey | NFUTZITXSQKQDU-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|