C15H15N3O — CID 129036188
6-[(4-imidazol-1-ylphenoxy)methyl]-3,4-dihydropyridine (PubChem CID 129036188) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is 6-[(4-imidazol-1-ylphenoxy)methyl]-3,4-dihydropyridine.
| Compound Name | 6-[(4-imidazol-1-ylphenoxy)methyl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 129036188 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 6-[(4-imidazol-1-ylphenoxy)methyl]-3,4-dihydropyridine |
| SMILES | C1=NC(COc2ccc(-n3ccnc3)cc2)=CCC1 |
| InChI | InChI=1S/C15H15N3O/c1-2-8-17-13(3-1)11-19-15-6-4-14(5-7-15)18-10-9-16-12-18/h3-10,12H,1-2,11H2 |
| InChIKey | BUXGYMHLFMRXRH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |