C10H17NO — CID 129037184
2-[(6-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol (PubChem CID 129037184) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-[(6-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol.
| Compound Name | 2-[(6-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol |
|---|---|
| PubChem CID | 129037184 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-[(6-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol |
| SMILES | CC1C=CC=CC1CNCCO |
| InChI | InChI=1S/C10H17NO/c1-9-4-2-3-5-10(9)8-11-6-7-12/h2-5,9-12H,6-8H2,1H3 |
| InChIKey | GIOSTPFNBUGHQU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|