C10H17NO — CID 89017638
ethylamino-[(6S)-6-methylcyclohexa-2,4-dien-1-yl]methanol (PubChem CID 89017638) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is ethylamino-[(6S)-6-methylcyclohexa-2,4-dien-1-yl]methanol.
| Compound Name | ethylamino-[(6S)-6-methylcyclohexa-2,4-dien-1-yl]methanol |
|---|---|
| PubChem CID | 89017638 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | ethylamino-[(6S)-6-methylcyclohexa-2,4-dien-1-yl]methanol |
| SMILES | CCNC(O)C1C=CC=C[C@@H]1C |
| InChI | InChI=1S/C10H17NO/c1-3-11-10(12)9-7-5-4-6-8(9)2/h4-12H,3H2,1-2H3/t8-,9?,10?/m0/s1 |
| InChIKey | SIPJUBGCIGMMPS-IDKOKCKLSA-N |
| XLogP | 1.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|