C14H26N2O — CID 143814001
1-(cyclohexa-2,4-dien-1-ylmethylamino)-4-[ethyl(methyl)amino]butan-1-ol (PubChem CID 143814001) has the molecular formula C14H26N2O and a molecular weight of 238.38 g/mol. Its IUPAC name is 1-(cyclohexa-2,4-dien-1-ylmethylamino)-4-[ethyl(methyl)amino]butan-1-ol.
| Compound Name | 1-(cyclohexa-2,4-dien-1-ylmethylamino)-4-[ethyl(methyl)amino]butan-1-ol |
|---|---|
| PubChem CID | 143814001 |
| Molecular Formula | C14H26N2O |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.20 |
| IUPAC Name | 1-(cyclohexa-2,4-dien-1-ylmethylamino)-4-[ethyl(methyl)amino]butan-1-ol |
| SMILES | CCN(C)CCCC(O)NCC1C=CC=CC1 |
| InChI | InChI=1S/C14H26N2O/c1-3-16(2)11-7-10-14(17)15-12-13-8-5-4-6-9-13/h4-6,8,13-15,17H,3,7,9-12H2,1-2H3 |
| InChIKey | ZKUSZVFMTWMRIL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|