C19H23NO4S — CID 129039743
S-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-ethoxyphenyl]-N-hydroxycarbamothioate (PubChem CID 129039743) has the molecular formula C19H23NO4S and a molecular weight of 361.46 g/mol. Its IUPAC name is S-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-ethoxyphenyl]-N-hydroxycarbamothioate.
| Compound Name | S-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-ethoxyphenyl]-N-hydroxycarbamothioate |
|---|---|
| PubChem CID | 129039743 |
| Molecular Formula | C19H23NO4S |
| Molecular Weight | 361.46 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | S-methyl N-[2-[(2,4-dimethylphenoxy)methyl]-4-ethoxyphenyl]-N-hydroxycarbamothioate |
| SMILES | CCOc1ccc(N(O)C(=O)SC)c(COc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C19H23NO4S/c1-5-23-16-7-8-17(20(22)19(21)25-4)15(11-16)12-24-18-9-6-13(2)10-14(18)3/h6-11,22H,5,12H2,1-4H3 |
| InChIKey | IFMBLKAHXVPLNK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|