C19H21NO4 — CID 129040587
methyl N-[2-[(2,4-dimethylphenoxy)methyl]-6-ethenylphenyl]-N-hydroxycarbamate (PubChem CID 129040587) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl N-[2-[(2,4-dimethylphenoxy)methyl]-6-ethenylphenyl]-N-hydroxycarbamate.
| Compound Name | methyl N-[2-[(2,4-dimethylphenoxy)methyl]-6-ethenylphenyl]-N-hydroxycarbamate |
|---|---|
| PubChem CID | 129040587 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | methyl N-[2-[(2,4-dimethylphenoxy)methyl]-6-ethenylphenyl]-N-hydroxycarbamate |
| SMILES | C=Cc1cccc(COc2ccc(C)cc2C)c1N(O)C(=O)OC |
| InChI | InChI=1S/C19H21NO4/c1-5-15-7-6-8-16(18(15)20(22)19(21)23-4)12-24-17-10-9-13(2)11-14(17)3/h5-11,22H,1,12H2,2-4H3 |
| InChIKey | FNHLNJVJSAOANS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|