C21H21F3N3O4S- — CID 129042748
1-[4-(sulfinatoamino)benzoyl]-4-[2-[4-(trifluoromethyl)phenyl]acetyl]-1,4-diazepane (PubChem CID 129042748) has the molecular formula C21H21F3N3O4S- and a molecular weight of 468.48 g/mol. Its IUPAC name is 1-[4-(sulfinatoamino)benzoyl]-4-[2-[4-(trifluoromethyl)phenyl]acetyl]-1,4-diazepane.
| Compound Name | 1-[4-(sulfinatoamino)benzoyl]-4-[2-[4-(trifluoromethyl)phenyl]acetyl]-1,4-diazepane |
|---|---|
| PubChem CID | 129042748 |
| Molecular Formula | C21H21F3N3O4S- |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 1-[4-(sulfinatoamino)benzoyl]-4-[2-[4-(trifluoromethyl)phenyl]acetyl]-1,4-diazepane |
| SMILES | O=C(Cc1ccc(C(F)(F)F)cc1)N1CCCN(C(=O)c2ccc(NS(=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C21H22F3N3O4S/c22-21(23,24)17-6-2-15(3-7-17)14-19(28)26-10-1-11-27(13-12-26)20(29)16-4-8-18(9-5-16)25-32(30)31/h2-9,25H,1,10-14H2,(H,30,31)/p-1 |
| InChIKey | QARVXDCTTMDQPZ-UHFFFAOYSA-M |
| XLogP | 2.83 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|