C22H36O5 — CID 129044676
(2'S,5'S,16'S)-2',9',16'-trimethylspiro[1,3-dioxolane-2,15'-10-oxatetracyclo[9.7.0.02,7.012,16]octadecane]-5',9'-diol (PubChem CID 129044676) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (2'S,5'S,16'S)-2',9',16'-trimethylspiro[1,3-dioxolane-2,15'-10-oxatetracyclo[9.7.0.02,7.012,16]octadecane]-5',9'-diol.
| Compound Name | (2'S,5'S,16'S)-2',9',16'-trimethylspiro[1,3-dioxolane-2,15'-10-oxatetracyclo[9.7.0.02,7.012,16]octadecane]-5',9'-diol |
|---|---|
| PubChem CID | 129044676 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (2'S,5'S,16'S)-2',9',16'-trimethylspiro[1,3-dioxolane-2,15'-10-oxatetracyclo[9.7.0.02,7.012,16]octadecane]-5',9'-diol |
| SMILES | CC1(O)CC2C[C@@H](O)CC[C@]2(C)C2CC[C@@]3(C)C(CCC34OCCO4)C2O1 |
| InChI | InChI=1S/C22H36O5/c1-19-7-4-15(23)12-14(19)13-21(3,24)27-18-16(19)5-8-20(2)17(18)6-9-22(20)25-10-11-26-22/h14-18,23-24H,4-13H2,1-3H3/t14?,15-,16?,17?,18?,19-,20-,21?/m0/s1 |
| InChIKey | HJQXYOOOIURCRV-WQYDFPAVSA-N |
| XLogP | 3.22 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |