C8H16N2 — CID 129045484
(E)-N-ethyl-5-iminohex-3-en-1-amine (PubChem CID 129045484) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is (E)-N-ethyl-5-iminohex-3-en-1-amine.
| Compound Name | (E)-N-ethyl-5-iminohex-3-en-1-amine |
|---|---|
| PubChem CID | 129045484 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | (E)-N-ethyl-5-iminohex-3-en-1-amine |
| SMILES | [H]/N=C(C)/C=C/CCNCC |
| InChI | InChI=1S/C8H16N2/c1-3-10-7-5-4-6-8(2)9/h4,6,9-10H,3,5,7H2,1-2H3/b6-4+,9-8+ |
| InChIKey | MJPXXBRTRCMFDG-ICNYKPIKSA-N |
| XLogP | 1.58 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|