C8H13N2+ — CID 59831277
(4-iminocyclohexa-2,5-dien-1-yl)-dimethylazanium (PubChem CID 59831277) has the molecular formula C8H13N2+ and a molecular weight of 137.21 g/mol. Its IUPAC name is (4-iminocyclohexa-2,5-dien-1-yl)-dimethylazanium.
| Compound Name | (4-iminocyclohexa-2,5-dien-1-yl)-dimethylazanium |
|---|---|
| PubChem CID | 59831277 |
| Molecular Formula | C8H13N2+ |
| Molecular Weight | 137.21 g/mol |
| Exact Mass | 137.11 |
| IUPAC Name | (4-iminocyclohexa-2,5-dien-1-yl)-dimethylazanium |
| SMILES | [H]N=C1C=CC([NH+](C)C)C=C1 |
| InChI | InChI=1S/C8H12N2/c1-10(2)8-5-3-7(9)4-6-8/h3-6,8-9H,1-2H3/p+1/b9-7- |
| InChIKey | SEIFAADDZRGMGO-CLFYSBASSA-O |
| XLogP | -0.35 |
| TPSA | 28.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.21 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|