C10H16N2 — CID 118199222
N-ethyl-4-ethyliminocyclohexa-2,5-dien-1-amine (PubChem CID 118199222) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N-ethyl-4-ethyliminocyclohexa-2,5-dien-1-amine.
| Compound Name | N-ethyl-4-ethyliminocyclohexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 118199222 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-ethyl-4-ethyliminocyclohexa-2,5-dien-1-amine |
| SMILES | CCN=C1C=CC(NCC)C=C1 |
| InChI | InChI=1S/C10H16N2/c1-3-11-9-5-7-10(8-6-9)12-4-2/h5-9,11H,3-4H2,1-2H3/b12-10- |
| InChIKey | ANDXVHPOVMCWBZ-BENRWUELSA-N |
| XLogP | 1.55 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|