C12H11N5 — CID 14646212
4-diazo-N-(4-diazocyclohexa-2,5-dien-1-yl)cyclohexa-2,5-dien-1-amine (PubChem CID 14646212) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-diazo-N-(4-diazocyclohexa-2,5-dien-1-yl)cyclohexa-2,5-dien-1-amine.
| Compound Name | 4-diazo-N-(4-diazocyclohexa-2,5-dien-1-yl)cyclohexa-2,5-dien-1-amine |
|---|---|
| PubChem CID | 14646212 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-diazo-N-(4-diazocyclohexa-2,5-dien-1-yl)cyclohexa-2,5-dien-1-amine |
| SMILES | [N-]=[N+]=C1C=CC(NC2C=CC(=[N+]=[N-])C=C2)C=C1 |
| InChI | InChI=1S/C12H11N5/c13-16-11-5-1-9(2-6-11)15-10-3-7-12(17-14)8-4-10/h1-10,15H |
| InChIKey | DEHGUSQPXSIVLB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|