C21H25F3IN3O3 — CID 129047443
ethyl (3S)-3-(butoxymethyl)-6-iodo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxylate (PubChem CID 129047443) has the molecular formula C21H25F3IN3O3 and a molecular weight of 551.35 g/mol. Its IUPAC name is ethyl (3S)-3-(butoxymethyl)-6-iodo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxylate.
| Compound Name | ethyl (3S)-3-(butoxymethyl)-6-iodo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxylate |
|---|---|
| PubChem CID | 129047443 |
| Molecular Formula | C21H25F3IN3O3 |
| Molecular Weight | 551.35 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | ethyl (3S)-3-(butoxymethyl)-6-iodo-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroimidazo[2,1-e]pyrazole-7-carboxylate |
| SMILES | CCCCOC[C@@H]1CN(Cc2cccc(C(F)(F)F)c2)c2c(C(=O)OCC)c(I)nn21 |
| InChI | InChI=1S/C21H25F3IN3O3/c1-3-5-9-30-13-16-12-27(11-14-7-6-8-15(10-14)21(22,23)24)19-17(20(29)31-4-2)18(25)26-28(16)19/h6-8,10,16H,3-5,9,11-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | COHWBNZOKUOWBK-INIZCTEOSA-N |
| XLogP | 5.06 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.35 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|